![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | 1. Certificate Course in Data Science 2. Certificate Course in Machine Learning with Python Programming 3. Certificate Course in Digital Health.pdf | 2023-11-29 13:59 | 970K | |
| 2021-01-08 12:19:57-Adichunchanagiri Institute Recognition Dis-affiliation.pdf | 2023-11-29 13:59 | 371K | |
| 2021-01-08 12:20:12-Dalailama Research Centre Change of Address.pdf | 2023-11-29 14:00 | 397K | |
| 2021-01-08 12:20:26-List of Recognition guides-2019.pdf | 2023-11-29 14:00 | 364K | |
| 2021-01-08 12:20:43-Sahajmarg RC Change of Address.pdf | 2023-11-29 14:00 | 3.0M | |
| 2021-01-08 12:21:05-Acharya Institute Recognition Notification.pdf | 2023-11-29 14:00 | 622K | |
| 2021-01-08 12:21:22-Admission Notification 2020-21.pdf | 2023-11-29 13:59 | 373K | |
| 2021-01-08 12:21:44-Admission notification of specialized.pdf | 2023-11-29 14:00 | 2.0M | |
| 2021-01-08 12:22:12-Change of Address of Specialized Centre.pdf | 2023-11-29 13:59 | 1.2M | |
| 2021-01-08 12:22:41-change of address SAIACS.pdf | 2023-11-29 13:59 | 1.8M | |
| 2021-01-08 12:23:03-Change of Address.pdf | 2023-11-29 14:00 | 579K | |
| 2021-01-08 12:23:32-eligibility certificte 2020.pdf | 2023-11-29 14:00 | 637K | |
| 2021-01-08 12:23:46-Fortuna Advanced Institute Of Research & Studies(FAIR), Recognition Notification.pdf | 2023-11-29 13:59 | 53K | |
| 2021-01-08 12:24:07-ICBio Change of Address.pdf | 2023-11-29 13:59 | 724K | |
| 2021-01-08 12:25:25-IIFA Education Centre Recognition.pdf | 2023-11-29 13:59 | 773K | |
| 2021-01-08 12:26:09-internaitional college of financial Planning.pdf | 2023-11-29 13:59 | 1.8M | |
| 2021-01-08 12:26:51-International Institute for Assisted Reproductive Technology and Research Centre change of addresst.pdf | 2023-11-29 14:00 | 1.8M | |
| 2021-01-08 12:27:09-Non- Recognition specialized notification.pdf | 2023-11-29 13:59 | 417K | |
| 2021-01-08 12:27:28-Sampoorna Additional Intake.pdf | 2023-11-29 14:00 | 327K | |
| 2021-01-08 12:28:06-UGC new nomenclature.pdf | 2023-11-29 13:59 | 701K | |
| 2021-01-08 12:30:17-Ayur Matam B.sc & ayurveda courses.pdf | 2023-11-29 13:59 | 25M | |
| 2021-01-08 12:31:15-BBA Aviation Hospitality and Tourism.pdf | 2023-11-29 14:00 | 5.0M | |
| 2021-01-08 12:32:19-ICFP BBA Enterprenurship.pdf | 2023-11-29 13:59 | 6.1M | |
| 2021-01-08 12:33:12-ICFP BBA financial planning.pdf | 2023-11-29 14:00 | 9.3M | |
| 2021-01-08 12:38:23-ICFP MA(fashion entrepreneurship) M.com(financial planning) and M.com(financial analysis).pdf | 2023-11-29 14:00 | 63M | |
| 2021-01-08 12:43:22-Kannada Academy -certificate course in kannada language and culture.pdf | 2023-11-29 13:59 | 1.8M | |
| 2021-01-08 12:45:31-Kuwait B.com(accounting and finance) BBA(marketing human resource) and BA(interior design).pdf | 2023-11-29 14:00 | 23M | |
| 2021-01-08 12:46:01-Maharaja Aviation Academy B.sc. aviation.pdf | 2023-11-29 13:59 | 8.5M | |
| 2021-01-08 12:47:27-Malabar Institute B.sc optomertry.pdf | 2023-11-29 13:59 | 23M | |
| 2021-01-08 12:48:16-Modified syllabus of B.sc (.digital art and animation).pdf | 2023-11-29 14:00 | 1.8M | |
| 2021-01-08 12:51:06-Modify syllabus M.sc (assisted reproduction and embryology).pdf | 2023-11-29 13:59 | 7.6M | |
| 2021-01-08 12:51:50-Natana-Diploma in theatre and certificate course in theatre acting.pdf | 2023-11-29 13:59 | 7.8M | |
| 2021-01-08 12:53:58-Sarada Vilas -B.Sc.(Hons) (Data Science & Artificial Intelligence).pdf | 2023-11-29 14:00 | 25M | |
| 2021-01-08 12:55:24-Ph.D. regulations approved from the government-02.pdf | 2023-11-29 13:59 | 67K | |
| 2021-01-08 12:56:27-Ph.D. Regulations.pdf | 2023-11-29 13:59 | 5.9M | |
| 2021-01-08 12:57:11-statutes.pdf | 2023-11-29 14:00 | 3.1M | |
| 2021-01-08 12:57:28-Recognition from relevent statutory body.pdf | 2023-11-29 13:59 | 1.1M | |
| 2021-01-08 12:58:14-specialized_statutes.pdf | 2023-11-29 13:59 | 3.1M | |
| 2021-01-08 12:59:14-ug-regulations-2020-02.pdf | 2023-11-29 13:59 | 7.5M | |
| 2021-01-08 12:59:50-Foreign UniversitiesInstitutes Statutes 2008.pdf | 2023-11-29 13:59 | 375K | |
| 2021-01-08 13:01:17-research_center_application_and_fee_final_2017-18.pdf | 2023-11-29 13:59 | 277K | |
| 2021-01-08 13:01:47-research_center_circular-3172017.pdf | 2023-11-29 14:00 | 449K | |
| 2021-01-08 13:02:21-Research VISA applicaitons.pdf | 2023-11-29 13:59 | 607K | |
| 2021-01-08 13:02:47-Appilication Form of Specialized Programme.pdf | 2023-11-29 13:59 | 72K | |
| 2021-01-08 13:03:13-specialized_application_1.pdf | 2023-11-29 13:59 | 418K | |
| 2021-01-08 13:03:47-Research Centre MOU Draft.pdf | 2023-11-29 13:59 | 120K | |
| 2021-01-08 13:04:16-Draft MOU for Specialized Programm.pdf | 2023-11-29 13:59 | 167K | |
| 2021-01-08 13:05:03-Fee structures 19.pdf | 2023-11-29 14:00 | 2.5M | |
| 2021-01-08 13:05:19-fee_stru.2019.pdf | 2023-11-29 14:00 | 182K | |
| 2021-01-08 13:05:51-circular exam fee and other service 2019.pdf | 2023-11-29 14:00 | 148K | |
| 2021-01-08 13:06:04-Fee structure 2020-21 (Modified) (PDF), 363.pdf | 2023-11-29 13:59 | 872K | |
| 2021-01-08 13:06:18-Foreign Institute Admission Fee Structure.pdf | 2023-11-29 13:59 | 263K | |
| 2021-01-08 13:06:44-specialized_fee_structure 2018-19.pdf | 2023-11-29 13:59 | 1.0M | |
| 2021-01-08 13:07:30-specilazed fee structures 2019-20.pdf | 2023-11-29 13:59 | 2.5M | |
| 2021-01-08 13:08:12-list_of_research_centre_2019_20.pdf | 2023-11-29 13:59 | 195K | |
| 2021-01-08 13:08:52-research_centre_for_academic_year_2018-19-02.pdf | 2023-11-29 13:59 | 2.0M | |
| 2021-01-08 13:09:07-List of Specialized Centre 2020-21.pdf | 2023-11-29 13:59 | 172K | |
| 2021-01-08 13:09:20-List of Specialized Programme 2018-19.pdf | 2023-11-29 13:59 | 63K | |
| 2021-01-08 13:09:42-List of Specialized Programme 2019-20.pdf | 2023-11-29 14:00 | 665K | |
| 2021-01-08 13:09:55-MOU_List_2014-15.pdf | 2023-11-29 13:59 | 184K | |
| 2021-08-25 17:47:44-B.Com-Hons..pdf | 2023-11-29 13:59 | 3.4M | |
| 2021-08-25 17:52:01-BBA-Hons..pdf | 2023-11-29 13:59 | 3.3M | |
| 2021-08-27 16:29:12-Appilication Form of Specialized Programme.pdf | 2023-11-29 13:59 | 28K | |
| 2021-08-27 16:33:52-Appilication Form of Specialized Programme.pdf | 2023-11-29 13:59 | 28K | |
| 2021-12-22 11:45:43-List of Research Centres 2021-22.pdf | 2023-11-29 13:59 | 528K | |
| 2021-22 Admission Notification of Specialized Programmes.pdf | 2023-11-29 13:59 | 3.1M | |
| 2022-05-30 12:05:00-B.Sc.(Optometry) modified LTP.pdf | 2023-11-29 13:59 | 348K | |
| 2022-05-30 12:07:32-B.Sc.(Jewellery Design & Management).pdf | 2023-11-29 13:59 | 1.9M | |
| 2022-05-30 12:08:30-B.Sc.(Optometry) modified LTP.pdf | 2023-11-29 13:59 | 348K | |
| 2022-05-30 12:08:57-B.Sc.(Hons.)(Interior Design & Built Environment).pdf | 2023-11-29 13:59 | 1.7M | |
| Acharya Institute-B.Des.(Hons.) (Digital Architecture) minor modification.pdf | 2023-11-29 14:00 | 1.5M | |
| Asia Pacific Institute of Embryology- M.Sc(Clinical Embryology & Pre implantation Genetics).pdf | 2023-11-29 13:59 | 2.3M | |
| Asia Pacific institute of Embryology-M.Sc(Clinical Embryology & pre implantation Genetics) minor modifications.pdf | 2023-11-29 14:00 | 2.4M | |
| B.Com-Hons..pdf | 2023-11-29 14:00 | 3.4M | |
| B.Com.(Financial Markets) Notification & Syllabus.pdf | 2023-11-29 13:59 | 889K | |
| B.Sc.(Food Processing & Quality Management) 2nd & 3rd Year Syllabus.pdf | 2023-11-29 13:59 | 969K | |
| B.Sc.(Forensic Science) 2nd & 3rd Year Syllabus.pdf | 2023-11-29 13:59 | 948K | |
| B.Sc.(Geology) 2nd & 3rd year Syllabus.pdf | 2023-11-29 14:00 | 1.0M | |
| B B A(Aviation Management) Modified Syllabus.pdf | 2023-11-29 14:00 | 4.4M | |
| BBA(Communication & Media Management) Notification & Syllabus.pdf | 2023-11-29 13:59 | 868K | |
| BBA ( Modelling & Fashion Management) Notification & Syllabus.pdf | 2023-11-29 13:59 | 871K | |
| BBA-Hons..pdf | 2023-11-29 13:59 | 3.3M | |
| BCA (Cloud Computing and Digital Science).pdf | 2023-11-29 13:59 | 786K | |
| BCA (Internet of Things) Syllabus.pdf | 2023-11-29 13:59 | 781K | |
| BSD Cresta-B.Des.(Hons.)( Architectural design construction).pdf | 2023-11-29 13:59 | 1.7M | |
| BSD Cresta-B.Des.(Hons.) (Structural civil design).pdf | 2023-11-29 14:00 | 1.8M | |
| Change of Nomenclature B.Des.-Hons.(Digital Architecture) & Syllabus.pdf | 2023-11-29 13:59 | 1.2M | |
| Cresta- 1st year B.Com (Hons.)(Financial Markets).pdf | 2023-11-29 13:59 | 8.6M | |
| Cresta-1st year BBA (Hons.) (Communication and Media Management).pdf | 2023-11-29 13:59 | 10M | |
| Cresta- 1st year BBA (Hons.) (Modelling & Fashion Management).pdf | 2023-11-29 13:59 | 10M | |
| Cresta -2nd year B.Com (Hons.)(Financial Markets).pdf | 2023-11-29 13:59 | 5.2M | |
| Cresta- 2nd year BBA (Hons.) (Communication & Media Management).pdf | 2023-11-29 13:59 | 6.2M | |
| Cresta-2nd year BBA (Hons.) Modelling & Fashion Management.pdf | 2023-11-29 13:59 | 5.3M | |
| Cresta -BCA(Hons) (Cloud Computing and Digital Science).pdf | 2023-11-29 13:59 | 8.1M | |
| Cresta-BCA(Hons)(Cloud computing & Digital Science).pdf | 2023-11-29 13:59 | 2.1M | |
| Cresta-BCA(Hons) Internet of things.pdf | 2023-11-29 13:59 | 2.2M | |
| GETS Academy- B.B.A(Hons.) (Business analytics), (Sustainable Development & Environment Management), (International Business).pdf | 2023-11-29 14:00 | 2.3M | |
| GETS Academy Notification 1.pdf | 2023-11-29 14:00 | 366K | |
| Gets Academy-B.Com(E-Com& DM), B.Com(F &I) and B.com (IA & F).pdf | 2023-11-29 13:59 | 2.0M | |
| Gupta- B.Sc & M.Sc(Graphics, Animation &VFX) B.Sc (Animation Gameing).pdf | 2023-11-29 13:59 | 2.9M | |
| Hindustan College-BBA (Aviation Management) minor modification.pdf | 2023-11-29 14:00 | 6.1M | |
| Hindustan college- BBA (Aviation Management).pdf | 2023-11-29 13:59 | 8.7M | |
| IIARTRC-M.Sc (Assisted reproduction and Embryology).pdf | 2023-11-29 13:59 | 1.7M | |
| IIARTRC-PG Diploma in Andrology& Clinical Embryology and Diploma in Yogic Science.pdf | 2023-11-29 13:59 | 2.2M | |
| IIFA Lancaster degree College-B.Sc.(Animation & Multimedia), (Game Designing & Development), (Visual Communication).pdf | 2023-11-29 13:59 | 2.0M | |
| IPec Recogn. order_0001.pdf | 2023-11-29 13:59 | 424K | |
| List of Research Centres 2021-22.pdf | 2023-11-29 13:59 | 528K | |
| List of Specialized Centre 2021-22-converted.pdf | 2023-11-29 13:59 | 251K | |
| MYCAS College- B.Com(Financial Management).pdf | 2023-11-29 14:00 | 1.6M | |
| Malabar Institute-B.Sc. (Optometry).pdf | 2023-11-29 14:00 | 1.5M | |
| Marian Institute-B.Sc. (Animation and VFX).pdf | 2023-11-29 14:00 | 1.8M | |
| Marian Institute- Film making.pdf | 2023-11-29 13:59 | 2.3M | |
| Marian Institute-MA Indian Christian Theology and Missiology.pdf | 2023-11-29 14:00 | 9.4M | |
| Research Centre Application.pdf | 2023-11-29 13:59 | 1.3M | |
| Research Centre Fee Structure 2021-2022.pdf | 2023-11-29 14:00 | 2.8M | |
| SAIACS-MA Theology.pdf | 2023-11-29 14:00 | 1.2M | |
| Sampoorna-M.Sc (Agri.) (Agronomy), (Genetics & plant breeding),(Entomology).pdf | 2023-11-29 13:59 | 6.3M | |
| Sarada Vilas College-B.Sc.(Hons.) (Data Science & Artificial Intelligence).pdf | 2023-11-29 13:59 | 2.6M | |
| Sera Jey-B.A(Hons.) Ancient Tibetan Language, Ancient Philosophy, Ancient Psychology.pdf | 2023-11-29 14:00 | 8.9M | |
| Specialized programme Fee Structure 2021-2022.pdf | 2023-11-29 13:59 | 3.2M | |
| Spl. Prgm. list_0001.pdf | 2023-11-29 13:59 | 2.3M | |
| Vogue Institute- B.Sc. (Hons.)(Jewellary design).pdf | 2023-11-29 13:59 | 1.4M | |
|
|---|